C16H26O6 — CID 139585575
(8R,13R,16R)-5,13-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadec-11-ene-2,10-dione (PubChem CID 139585575) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (8R,13R,16R)-5,13-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadec-11-ene-2,10-dione.
| Compound Name | (8R,13R,16R)-5,13-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadec-11-ene-2,10-dione |
|---|---|
| PubChem CID | 139585575 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (8R,13R,16R)-5,13-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadec-11-ene-2,10-dione |
| SMILES | C[C@@H]1CCC(O)CCC(=O)O[C@H](C)CC[C@@H](O)C=CC(=O)O1 |
| InChI | InChI=1S/C16H26O6/c1-11-3-5-13(17)8-10-16(20)22-12(2)4-6-14(18)7-9-15(19)21-11/h7,9,11-14,17-18H,3-6,8,10H2,1-2H3/t11-,12-,13?,14-/m1/s1 |
| InChIKey | SLMOZXAOZSMPIZ-MVWAYNQESA-N |
| XLogP | 1.48 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |