C9H13ClO4 — CID 139585586
(2R)-2-[(1S,2S,3R)-3-chloro-1,2-dihydroxybutyl]-4-methyl-2H-furan-5-one (PubChem CID 139585586) has the molecular formula C9H13ClO4 and a molecular weight of 220.65 g/mol. Its IUPAC name is (2R)-2-[(1S,2S,3R)-3-chloro-1,2-dihydroxybutyl]-4-methyl-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S,2S,3R)-3-chloro-1,2-dihydroxybutyl]-4-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 139585586 |
| Molecular Formula | C9H13ClO4 |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (2R)-2-[(1S,2S,3R)-3-chloro-1,2-dihydroxybutyl]-4-methyl-2H-furan-5-one |
| SMILES | CC1=C[C@H]([C@@H](O)[C@H](O)[C@@H](C)Cl)OC1=O |
| InChI | InChI=1S/C9H13ClO4/c1-4-3-6(14-9(4)13)8(12)7(11)5(2)10/h3,5-8,11-12H,1-2H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | LXHYBBQOYKTFIL-WCTZXXKLSA-N |
| XLogP | 0.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|