C16H24O6 — CID 139585662
(7S)-7-hydroxy-7-[(2S,6S)-6-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptanoic acid (PubChem CID 139585662) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (7S)-7-hydroxy-7-[(2S,6S)-6-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptanoic acid.
| Compound Name | (7S)-7-hydroxy-7-[(2S,6S)-6-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 139585662 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (7S)-7-hydroxy-7-[(2S,6S)-6-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptanoic acid |
| SMILES | O=C(O)CCCCC[C@H](O)[C@@H]1CCC2=C(CC[C@H](O)C2=O)O1 |
| InChI | InChI=1S/C16H24O6/c17-11(4-2-1-3-5-15(19)20)14-8-6-10-13(22-14)9-7-12(18)16(10)21/h11-12,14,17-18H,1-9H2,(H,19,20)/t11-,12-,14-/m0/s1 |
| InChIKey | SDEMLABHEIGMCS-OBJOEFQTSA-N |
| XLogP | 1.54 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|