C23H37NO3 — CID 139585663
(8S)-2-hexadec-6-enoyl-1-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one (PubChem CID 139585663) has the molecular formula C23H37NO3 and a molecular weight of 375.55 g/mol. Its IUPAC name is (8S)-2-hexadec-6-enoyl-1-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one.
| Compound Name | (8S)-2-hexadec-6-enoyl-1-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 139585663 |
| Molecular Formula | C23H37NO3 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | (8S)-2-hexadec-6-enoyl-1-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one |
| SMILES | CCCCCCCCCC=CCCCCC(=O)C1=C(O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C23H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20(25)21-22(26)19-16-15-18-24(19)23(21)27/h10-11,19,26H,2-9,12-18H2,1H3/t19-/m0/s1 |
| InChIKey | VSRFLISPWPFUNO-IBGZPJMESA-N |
| XLogP | 5.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|