C18H26O7 — CID 139585676
[(2R,5S,6Z,10R,13S,14Z)-13-hydroxy-2,10-dimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-6,14-dien-5-yl] acetate (PubChem CID 139585676) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is [(2R,5S,6Z,10R,13S,14Z)-13-hydroxy-2,10-dimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-6,14-dien-5-yl] acetate.
| Compound Name | [(2R,5S,6Z,10R,13S,14Z)-13-hydroxy-2,10-dimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-6,14-dien-5-yl] acetate |
|---|---|
| PubChem CID | 139585676 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(2R,5S,6Z,10R,13S,14Z)-13-hydroxy-2,10-dimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-6,14-dien-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1/C=C\C(=O)O[C@H](C)CC[C@H](O)/C=C\C(=O)O[C@H](C)CC1 |
| InChI | InChI=1S/C18H26O7/c1-12-4-6-15(20)7-10-17(21)24-13(2)5-8-16(25-14(3)19)9-11-18(22)23-12/h7,9-13,15-16,20H,4-6,8H2,1-3H3/b10-7-,11-9-/t12-,13-,15+,16+/m1/s1 |
| InChIKey | SYANJCUSPRVNHZ-QOXGVPRHSA-N |
| XLogP | 1.83 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|