C25H30N2O8 — CID 139585682
(2S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S)-1-carboxy-2-methylpropyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]butanedioic acid (PubChem CID 139585682) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is (2S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S)-1-carboxy-2-methylpropyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S)-1-carboxy-2-methylpropyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 139585682 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (2S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S)-1-carboxy-2-methylpropyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]butanedioic acid |
| SMILES | CC(C)[C@H](NC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=O)N[C@@H](CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C25H30N2O8/c1-18(2)23(25(34)35)27-21(29)16-14-12-10-8-6-4-3-5-7-9-11-13-15-20(28)26-19(24(32)33)17-22(30)31/h3-16,18-19,23H,17H2,1-2H3,(H,26,28)(H,27,29)(H,30,31)(H,32,33)(H,34,35)/b4-3+,7-5+,8-6+,11-9+,12-10+,15-13+,16-14+/t19-,23-/m0/s1 |
| InChIKey | TWBJULYXAIUUEZ-JPNMULMZSA-N |
| XLogP | 2.15 |
| TPSA | 170.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|