C15H24O — CID 139585683
(1R,4S,5S,8S,11R)-5,7,7,11-tetramethyltricyclo[6.3.0.01,5]undec-2-en-4-ol (PubChem CID 139585683) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (1R,4S,5S,8S,11R)-5,7,7,11-tetramethyltricyclo[6.3.0.01,5]undec-2-en-4-ol.
| Compound Name | (1R,4S,5S,8S,11R)-5,7,7,11-tetramethyltricyclo[6.3.0.01,5]undec-2-en-4-ol |
|---|---|
| PubChem CID | 139585683 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (1R,4S,5S,8S,11R)-5,7,7,11-tetramethyltricyclo[6.3.0.01,5]undec-2-en-4-ol |
| SMILES | C[C@@H]1CC[C@H]2C(C)(C)C[C@]3(C)[C@@H](O)C=C[C@]123 |
| InChI | InChI=1S/C15H24O/c1-10-5-6-11-13(2,3)9-14(4)12(16)7-8-15(10,11)14/h7-8,10-12,16H,5-6,9H2,1-4H3/t10-,11+,12+,14-,15+/m1/s1 |
| InChIKey | ZYETUZMHJIJQQT-NUNXZZDCSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|