About 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one
2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one (PubChem CID 139585723) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one.
Molecular Properties
| Compound Name | 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one |
| PubChem CID | 139585723 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one |
| SMILES | CC(CCC(=O)C(C)(C)O)[C@@H]1C=C[C@@](C)(O)CC1 |
| InChI | InChI=1S/C15H26O3/c1-11(5-6-13(16)14(2,3)17)12-7-9-15(4,18)10-8-12/h7,9,11-12,17-18H,5-6,8,10H2,1-4H3/t11?,12-,15-/m1/s1 |
| InChIKey | SIPNOLNROKKJJJ-AADWAWOOSA-N |
| XLogP | 2.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one?
The IUPAC name of 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one (CID 139585723) is 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one.
What is the SMILES notation for 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one?
The canonical SMILES for 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one is CC(CCC(=O)C(C)(C)O)[C@@H]1C=C[C@@](C)(O)CC1.
What is the InChIKey of 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one?
The InChIKey is SIPNOLNROKKJJJ-AADWAWOOSA-N. The full InChI is InChI=1S/C15H26O3/c1-11(5-6-13(16)14(2,3)17)12-7-9-15(4,18)10-8-12/h7,9,11-12,17-18H,5-6,8,10H2,1-4H3/t11?,12-,15-/m1/s1.
What are the key properties of 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one?
2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one has a molecular weight of 254.37 g/mol, XLogP of 2.46, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-6-[(1R,4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylheptan-3-one is sourced from PubChem (CID 139585723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).