About methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate
methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate (PubChem CID 139585765) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate.
Molecular Properties
| Compound Name | methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate |
| PubChem CID | 139585765 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate |
| SMILES | COC(=O)C(CO)/C(C)=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C15H18O3/c1-12(14(11-16)15(17)18-2)7-6-10-13-8-4-3-5-9-13/h3-10,14,16H,11H2,1-2H3/b10-6+,12-7- |
| InChIKey | OPZOWDBOKUGKIA-NGSBCVAZSA-N |
| XLogP | 2.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate?
The IUPAC name of methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate (CID 139585765) is methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate.
What is the SMILES notation for methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate?
The canonical SMILES for methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate is COC(=O)C(CO)/C(C)=C\C=C\c1ccccc1.
What is the InChIKey of methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate?
The InChIKey is OPZOWDBOKUGKIA-NGSBCVAZSA-N. The full InChI is InChI=1S/C15H18O3/c1-12(14(11-16)15(17)18-2)7-6-10-13-8-4-3-5-9-13/h3-10,14,16H,11H2,1-2H3/b10-6+,12-7-.
What are the key properties of methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate?
methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate has a molecular weight of 246.31 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3Z,5E)-2-(hydroxymethyl)-3-methyl-6-phenylhexa-3,5-dienoate is sourced from PubChem (CID 139585765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).