C34H43NO8 — CID 139585792
17,23,25-trihydroxy-24-methoxy-9,10,14,22-tetramethyl-7-(2-methylpropyl)-27-oxa-6-azahexacyclo[18.6.1.02,19.04,8.04,12.021,26]heptacosa-10,13,21,23,25-pentaene-3,5,18-trione (PubChem CID 139585792) has the molecular formula C34H43NO8 and a molecular weight of 593.72 g/mol. Its IUPAC name is 17,23,25-trihydroxy-24-methoxy-9,10,14,22-tetramethyl-7-(2-methylpropyl)-27-oxa-6-azahexacyclo[18.6.1.02,19.04,8.04,12.021,26]heptacosa-10,13,21,23,25-pentaene-3,5,18-trione.
| Compound Name | 17,23,25-trihydroxy-24-methoxy-9,10,14,22-tetramethyl-7-(2-methylpropyl)-27-oxa-6-azahexacyclo[18.6.1.02,19.04,8.04,12.021,26]heptacosa-10,13,21,23,25-pentaene-3,5,18-trione |
|---|---|
| PubChem CID | 139585792 |
| Molecular Formula | C34H43NO8 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | 17,23,25-trihydroxy-24-methoxy-9,10,14,22-tetramethyl-7-(2-methylpropyl)-27-oxa-6-azahexacyclo[18.6.1.02,19.04,8.04,12.021,26]heptacosa-10,13,21,23,25-pentaene-3,5,18-trione |
| SMILES | COc1c(O)c(C)c2c(c1O)C1OC2C2C(=O)C(O)CCC(C)=CC3C=C(C)C(C)C4C(CC(C)C)NC(=O)C34C(=O)C12 |
| InChI | InChI=1S/C34H43NO8/c1-13(2)10-19-25-16(5)15(4)12-18-11-14(3)8-9-20(36)27(38)23-24(32(40)34(18,25)33(41)35-19)30-22-21(29(23)43-30)17(6)26(37)31(42-7)28(22)39/h11-13,16,18-20,23-25,29-30,36-37,39H,8-10H2,1-7H3,(H,35,41) |
| InChIKey | HMFDSIGNMYZFJO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|