About 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol
4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol (PubChem CID 139585970) has the molecular formula C21H36N2O
and a molecular weight of 332.53 g/mol. Its IUPAC name is 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol.
Molecular Properties
| Compound Name | 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol |
| PubChem CID | 139585970 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol |
| SMILES | CCC(C)CC(C)C=CCCC(N)C(Cc1ccc(O)cc1)NC |
| InChI | InChI=1S/C21H36N2O/c1-5-16(2)14-17(3)8-6-7-9-20(22)21(23-4)15-18-10-12-19(24)13-11-18/h6,8,10-13,16-17,20-21,23-24H,5,7,9,14-15,22H2,1-4H3 |
| InChIKey | IBEFHERIICGKCU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol?
The IUPAC name of 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol (CID 139585970) is 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol.
What is the SMILES notation for 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol?
The canonical SMILES for 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol is CCC(C)CC(C)C=CCCC(N)C(Cc1ccc(O)cc1)NC.
What is the InChIKey of 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol?
The InChIKey is IBEFHERIICGKCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36N2O/c1-5-16(2)14-17(3)8-6-7-9-20(22)21(23-4)15-18-10-12-19(24)13-11-18/h6,8,10-13,16-17,20-21,23-24H,5,7,9,14-15,22H2,1-4H3.
What are the key properties of 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol?
4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol has a molecular weight of 332.53 g/mol, XLogP of 4.26, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-amino-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol is sourced from PubChem (CID 139585970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).