C14H20O3 — CID 139585996
(1R,2S,4R,6R,7S)-4-hydroxy-10-(hydroxymethyl)-2,6-dimethyltricyclo[5.3.1.02,6]undec-9-en-8-one (PubChem CID 139585996) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1R,2S,4R,6R,7S)-4-hydroxy-10-(hydroxymethyl)-2,6-dimethyltricyclo[5.3.1.02,6]undec-9-en-8-one.
| Compound Name | (1R,2S,4R,6R,7S)-4-hydroxy-10-(hydroxymethyl)-2,6-dimethyltricyclo[5.3.1.02,6]undec-9-en-8-one |
|---|---|
| PubChem CID | 139585996 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1R,2S,4R,6R,7S)-4-hydroxy-10-(hydroxymethyl)-2,6-dimethyltricyclo[5.3.1.02,6]undec-9-en-8-one |
| SMILES | C[C@@]12C[C@@H](O)C[C@]1(C)[C@@H]1C[C@H]2C(CO)=CC1=O |
| InChI | InChI=1S/C14H20O3/c1-13-5-9(16)6-14(13,2)11-4-10(13)8(7-15)3-12(11)17/h3,9-11,15-16H,4-7H2,1-2H3/t9-,10+,11-,13+,14-/m1/s1 |
| InChIKey | PKKKBFDTUPEZHH-QJRXBVQLSA-N |
| XLogP | 1.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |