About 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone
1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone (PubChem CID 139586037) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone |
| PubChem CID | 139586037 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone |
| SMILES | COC1=C(C)O[C@H]2OC(C)=CC(C(C)=O)=C12 |
| InChI | InChI=1S/C12H14O4/c1-6-5-9(7(2)13)10-11(14-4)8(3)16-12(10)15-6/h5,12H,1-4H3/t12-/m1/s1 |
| InChIKey | VYUXCMNBSLJEAW-GFCCVEGCSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone?
The IUPAC name of 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone (CID 139586037) is 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone.
What is the SMILES notation for 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone?
The canonical SMILES for 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone is COC1=C(C)O[C@H]2OC(C)=CC(C(C)=O)=C12.
What is the InChIKey of 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone?
The InChIKey is VYUXCMNBSLJEAW-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H14O4/c1-6-5-9(7(2)13)10-11(14-4)8(3)16-12(10)15-6/h5,12H,1-4H3/t12-/m1/s1.
What are the key properties of 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone?
1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone has a molecular weight of 222.24 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]ethanone is sourced from PubChem (CID 139586037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).