C15H18O2 — CID 139586082
(5R)-5,7,7-trimethyl-4,5,6,8-tetrahydroazuleno[5,6-c]furan-1-one (PubChem CID 139586082) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (5R)-5,7,7-trimethyl-4,5,6,8-tetrahydroazuleno[5,6-c]furan-1-one.
| Compound Name | (5R)-5,7,7-trimethyl-4,5,6,8-tetrahydroazuleno[5,6-c]furan-1-one |
|---|---|
| PubChem CID | 139586082 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (5R)-5,7,7-trimethyl-4,5,6,8-tetrahydroazuleno[5,6-c]furan-1-one |
| SMILES | C[C@@H]1CC2=COC(=O)C2=CC2=C1CC(C)(C)C2 |
| InChI | InChI=1S/C15H18O2/c1-9-4-11-8-17-14(16)12(11)5-10-6-15(2,3)7-13(9)10/h5,8-9H,4,6-7H2,1-3H3/t9-/m1/s1 |
| InChIKey | ARXVQLVJQUHCDP-SECBINFHSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|