C14H14O4 — CID 139586086
3-methyl-4-[(1E,3E,5Z)-6-methyl-7-oxoocta-1,3,5-trienyl]furan-2,5-dione (PubChem CID 139586086) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 3-methyl-4-[(1E,3E,5Z)-6-methyl-7-oxoocta-1,3,5-trienyl]furan-2,5-dione.
| Compound Name | 3-methyl-4-[(1E,3E,5Z)-6-methyl-7-oxoocta-1,3,5-trienyl]furan-2,5-dione |
|---|---|
| PubChem CID | 139586086 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 3-methyl-4-[(1E,3E,5Z)-6-methyl-7-oxoocta-1,3,5-trienyl]furan-2,5-dione |
| SMILES | CC(=O)/C(C)=C\C=C\C=C\C1=C(C)C(=O)OC1=O |
| InChI | InChI=1S/C14H14O4/c1-9(11(3)15)7-5-4-6-8-12-10(2)13(16)18-14(12)17/h4-8H,1-3H3/b5-4+,8-6+,9-7- |
| InChIKey | DPZNQXPHRMGJIG-OEBYFBIZSA-N |
| XLogP | 2.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|