C20H32O2 — CID 139586212
8-(hydroxymethyl)-4,14,15,15-tetramethylbicyclo[9.3.1]pentadeca-1(14),4,8-trien-6-ol (PubChem CID 139586212) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 8-(hydroxymethyl)-4,14,15,15-tetramethylbicyclo[9.3.1]pentadeca-1(14),4,8-trien-6-ol.
| Compound Name | 8-(hydroxymethyl)-4,14,15,15-tetramethylbicyclo[9.3.1]pentadeca-1(14),4,8-trien-6-ol |
|---|---|
| PubChem CID | 139586212 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 8-(hydroxymethyl)-4,14,15,15-tetramethylbicyclo[9.3.1]pentadeca-1(14),4,8-trien-6-ol |
| SMILES | CC1=CC(O)CC(CO)=CCC2CCC(C)=C(CC1)C2(C)C |
| InChI | InChI=1S/C20H32O2/c1-14-5-10-19-15(2)6-8-17(20(19,3)4)9-7-16(13-21)12-18(22)11-14/h7,11,17-18,21-22H,5-6,8-10,12-13H2,1-4H3 |
| InChIKey | GCPPQPWPLQETFO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|