C8H10O4 — CID 139586228
(1S,4R,7S,8S)-1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one (PubChem CID 139586228) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is (1S,4R,7S,8S)-1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one.
| Compound Name | (1S,4R,7S,8S)-1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one |
|---|---|
| PubChem CID | 139586228 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (1S,4R,7S,8S)-1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one |
| SMILES | C[C@]12C[C@@H]3C(=O)O[C@H](CO1)[C@H]3O2 |
| InChI | InChI=1S/C8H10O4/c1-8-2-4-6(12-8)5(3-10-8)11-7(4)9/h4-6H,2-3H2,1H3/t4-,5+,6-,8-/m0/s1 |
| InChIKey | CLPLRRVKMWVWPU-GCJQMDKQSA-N |
| XLogP | 0.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |