C25H40 — CID 139586234
(3S,6R,7S,11R,14S)-3,10,14-trimethyl-6-[(2S)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradeca-1,9-diene (PubChem CID 139586234) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (3S,6R,7S,11R,14S)-3,10,14-trimethyl-6-[(2S)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradeca-1,9-diene.
| Compound Name | (3S,6R,7S,11R,14S)-3,10,14-trimethyl-6-[(2S)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradeca-1,9-diene |
|---|---|
| PubChem CID | 139586234 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (3S,6R,7S,11R,14S)-3,10,14-trimethyl-6-[(2S)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradeca-1,9-diene |
| SMILES | CC(C)=CCC[C@H](C)[C@H]1CC[C@]2(C)C=C3[C@H](CC[C@@H]3C)C(C)=CC[C@@H]12 |
| InChI | InChI=1S/C25H40/c1-17(2)8-7-9-18(3)22-14-15-25(6)16-23-20(5)10-12-21(23)19(4)11-13-24(22)25/h8,11,16,18,20-22,24H,7,9-10,12-15H2,1-6H3/t18-,20-,21+,22+,24-,25+/m0/s1 |
| InChIKey | HVZVENPVUYEHDQ-LJUDRSLLSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|