C15H18O4 — CID 139586293
(2R,6S)-3,3,11,11-tetramethyl-7-oxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,8,10-trione (PubChem CID 139586293) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (2R,6S)-3,3,11,11-tetramethyl-7-oxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,8,10-trione.
| Compound Name | (2R,6S)-3,3,11,11-tetramethyl-7-oxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,8,10-trione |
|---|---|
| PubChem CID | 139586293 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2R,6S)-3,3,11,11-tetramethyl-7-oxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,8,10-trione |
| SMILES | CC1(C)CC2=C(C(=O)O[C@H]3CC(=O)C(C)(C)[C@@H]23)C1=O |
| InChI | InChI=1S/C15H18O4/c1-14(2)6-7-10(12(14)17)13(18)19-8-5-9(16)15(3,4)11(7)8/h8,11H,5-6H2,1-4H3/t8-,11-/m0/s1 |
| InChIKey | YPJVNNBPZVIFLM-KWQFWETISA-N |
| XLogP | 1.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|