C26H28O8 — CID 139586295
(2S,3R,4S,5S,6R)-2-(2,4-dimethoxy-3,6-diphenylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 139586295) has the molecular formula C26H28O8 and a molecular weight of 468.50 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(2,4-dimethoxy-3,6-diphenylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(2,4-dimethoxy-3,6-diphenylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 139586295 |
| Molecular Formula | C26H28O8 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(2,4-dimethoxy-3,6-diphenylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1cc(-c2ccccc2)c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(OC)c1-c1ccccc1 |
| InChI | InChI=1S/C26H28O8/c1-31-18-13-17(15-9-5-3-6-10-15)24(25(32-2)20(18)16-11-7-4-8-12-16)34-26-23(30)22(29)21(28)19(14-27)33-26/h3-13,19,21-23,26-30H,14H2,1-2H3/t19-,21-,22+,23-,26+/m1/s1 |
| InChIKey | GDPLQMBFEYGZBG-YRHADEBDSA-N |
| XLogP | 2.22 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |