C22H32O4 — CID 139586301
(1R,5S,6R)-5-hydroxy-4-methoxy-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 139586301) has the molecular formula C22H32O4 and a molecular weight of 360.50 g/mol. Its IUPAC name is (1R,5S,6R)-5-hydroxy-4-methoxy-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1R,5S,6R)-5-hydroxy-4-methoxy-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 139586301 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (1R,5S,6R)-5-hydroxy-4-methoxy-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(=CCCC(=CCCC(=CC[C@]12[C@H](O1)[C@@H](C(=CC2=O)OC)O)C)C)C |
| InChI | InChI=1S/C22H32O4/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-22-19(23)14-18(25-5)20(24)21(22)26-22/h8,10,12,14,20-21,24H,6-7,9,11,13H2,1-5H3/t20-,21-,22+/m1/s1 |
| InChIKey | URXBIEAAUGXNIJ-VSKRKVRLSA-N |
| XLogP | 4.40 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | 649 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|