C18H20O6 — CID 139586308
(3R,4S,12S,13S)-3,12-dimethyl-2,11-dioxatricyclo[12.4.0.05,10]octadeca-1(18),5,7,9,14,16-hexaene-4,6,13,15-tetrol (PubChem CID 139586308) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is (3R,4S,12S,13S)-3,12-dimethyl-2,11-dioxatricyclo[12.4.0.05,10]octadeca-1(18),5,7,9,14,16-hexaene-4,6,13,15-tetrol.
| Compound Name | (3R,4S,12S,13S)-3,12-dimethyl-2,11-dioxatricyclo[12.4.0.05,10]octadeca-1(18),5,7,9,14,16-hexaene-4,6,13,15-tetrol |
|---|---|
| PubChem CID | 139586308 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (3R,4S,12S,13S)-3,12-dimethyl-2,11-dioxatricyclo[12.4.0.05,10]octadeca-1(18),5,7,9,14,16-hexaene-4,6,13,15-tetrol |
| SMILES | C[C@@H]1Oc2cccc(O)c2[C@H](O)[C@@H](C)Oc2cccc(O)c2[C@@H]1O |
| InChI | InChI=1S/C18H20O6/c1-9-17(21)15-11(19)5-4-8-14(15)24-10(2)18(22)16-12(20)6-3-7-13(16)23-9/h3-10,17-22H,1-2H3/t9-,10+,17-,18-/m1/s1 |
| InChIKey | HTVPTLVEDCCJOB-AYBUMKCRSA-N |
| XLogP | 2.41 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |