C27H35NO4 — CID 139586314
(1S,2E,4R,7R,8S,9S,10E,12Z,14S,17R,19S,20R)-17-hexa-2,4-dienyl-7,8,19-trihydroxy-2,10-dimethyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one (PubChem CID 139586314) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is (1S,2E,4R,7R,8S,9S,10E,12Z,14S,17R,19S,20R)-17-hexa-2,4-dienyl-7,8,19-trihydroxy-2,10-dimethyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one.
| Compound Name | (1S,2E,4R,7R,8S,9S,10E,12Z,14S,17R,19S,20R)-17-hexa-2,4-dienyl-7,8,19-trihydroxy-2,10-dimethyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one |
|---|---|
| PubChem CID | 139586314 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (1S,2E,4R,7R,8S,9S,10E,12Z,14S,17R,19S,20R)-17-hexa-2,4-dienyl-7,8,19-trihydroxy-2,10-dimethyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one |
| SMILES | CC=CC=CC[C@@H]1C[C@H](O)[C@H]2[C@@H]3/C(C)=C/[C@H]4C=C[C@@H](O)[C@@H](O)[C@@H]4/C(C)=C/C=C\[C@@H]3C(=O)N12 |
| InChI | InChI=1S/C27H35NO4/c1-4-5-6-7-10-19-15-22(30)25-24-17(3)14-18-12-13-21(29)26(31)23(18)16(2)9-8-11-20(24)27(32)28(19)25/h4-9,11-14,18-26,29-31H,10,15H2,1-3H3/b5-4?,7-6?,11-8-,16-9+,17-14+/t18-,19-,20+,21-,22+,23-,24-,25+,26-/m1/s1 |
| InChIKey | HFNMIOGEGCXSJX-AZMABVKQSA-N |
| XLogP | 3.07 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|