C12H16O6 — CID 139586326
(1S,4S,5S,7S,10R,11S)-10-hydroxy-4-methoxy-4,11-dimethyl-3,6-dioxatricyclo[5.3.1.01,5]undecane-2,9-dione (PubChem CID 139586326) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is (1S,4S,5S,7S,10R,11S)-10-hydroxy-4-methoxy-4,11-dimethyl-3,6-dioxatricyclo[5.3.1.01,5]undecane-2,9-dione.
| Compound Name | (1S,4S,5S,7S,10R,11S)-10-hydroxy-4-methoxy-4,11-dimethyl-3,6-dioxatricyclo[5.3.1.01,5]undecane-2,9-dione |
|---|---|
| PubChem CID | 139586326 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (1S,4S,5S,7S,10R,11S)-10-hydroxy-4-methoxy-4,11-dimethyl-3,6-dioxatricyclo[5.3.1.01,5]undecane-2,9-dione |
| SMILES | CO[C@@]1(C)OC(=O)[C@@]23[C@H](C)[C@H](CC(=O)[C@@H]2O)O[C@H]13 |
| InChI | InChI=1S/C12H16O6/c1-5-7-4-6(13)8(14)12(5)9(17-7)11(2,16-3)18-10(12)15/h5,7-9,14H,4H2,1-3H3/t5-,7+,8+,9-,11+,12+/m1/s1 |
| InChIKey | NURINWLNSWNTQS-VGQFVTSBSA-N |
| XLogP | -0.37 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |