C15H20O2 — CID 139586582
(4R,10R,11S)-3-hydroxy-6,6,10-trimethyltricyclo[5.3.1.04,11]undeca-1,7-diene-4-carbaldehyde (PubChem CID 139586582) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (4R,10R,11S)-3-hydroxy-6,6,10-trimethyltricyclo[5.3.1.04,11]undeca-1,7-diene-4-carbaldehyde.
| Compound Name | (4R,10R,11S)-3-hydroxy-6,6,10-trimethyltricyclo[5.3.1.04,11]undeca-1,7-diene-4-carbaldehyde |
|---|---|
| PubChem CID | 139586582 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (4R,10R,11S)-3-hydroxy-6,6,10-trimethyltricyclo[5.3.1.04,11]undeca-1,7-diene-4-carbaldehyde |
| SMILES | C[C@@H]1CC=C2[C@@H]3C1=CC(O)[C@@]3(C=O)CC2(C)C |
| InChI | InChI=1S/C15H20O2/c1-9-4-5-11-13-10(9)6-12(17)15(13,8-16)7-14(11,2)3/h5-6,8-9,12-13,17H,4,7H2,1-3H3/t9-,12?,13+,15+/m1/s1 |
| InChIKey | XDBPRDMNIFDILA-XKNHMUDWSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|