C21H23NO6 — CID 139586596
4-hydroxy-3-[(2E,4E,6R,7R)-7-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoyl]-5-(4-hydroxyphenyl)-1H-pyridin-2-one (PubChem CID 139586596) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is 4-hydroxy-3-[(2E,4E,6R,7R)-7-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoyl]-5-(4-hydroxyphenyl)-1H-pyridin-2-one.
| Compound Name | 4-hydroxy-3-[(2E,4E,6R,7R)-7-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoyl]-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 139586596 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-hydroxy-3-[(2E,4E,6R,7R)-7-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoyl]-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
| SMILES | CC(/C=C/C(=O)c1c(O)c(-c2ccc(O)cc2)c[nH]c1=O)=C\[C@H](CO)[C@@H](C)O |
| InChI | InChI=1S/C21H23NO6/c1-12(9-15(11-23)13(2)24)3-8-18(26)19-20(27)17(10-22-21(19)28)14-4-6-16(25)7-5-14/h3-10,13,15,23-25H,11H2,1-2H3,(H2,22,27,28)/b8-3+,12-9+/t13-,15-/m1/s1 |
| InChIKey | ZYUMDIZFBOZASO-PZGALRHLSA-N |
| XLogP | 2.13 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|