C20H32O8 — CID 139586611
4-[[(2R,3S,4S,7S)-2-heptyl-3,4-dihydroxy-10-oxo-2,3,4,7,8,9-hexahydrooxecin-7-yl]oxy]-4-oxobutanoic acid (PubChem CID 139586611) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,7S)-2-heptyl-3,4-dihydroxy-10-oxo-2,3,4,7,8,9-hexahydrooxecin-7-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(2R,3S,4S,7S)-2-heptyl-3,4-dihydroxy-10-oxo-2,3,4,7,8,9-hexahydrooxecin-7-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139586611 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 4-[[(2R,3S,4S,7S)-2-heptyl-3,4-dihydroxy-10-oxo-2,3,4,7,8,9-hexahydrooxecin-7-yl]oxy]-4-oxobutanoic acid |
| SMILES | CCCCCCC[C@H]1OC(=O)CC[C@H](OC(=O)CCC(=O)O)C=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H32O8/c1-2-3-4-5-6-7-16-20(26)15(21)10-8-14(9-12-19(25)28-16)27-18(24)13-11-17(22)23/h8,10,14-16,20-21,26H,2-7,9,11-13H2,1H3,(H,22,23)/t14-,15+,16-,20+/m1/s1 |
| InChIKey | OUOHBCJNWADUGG-ASKKUZCQSA-N |
| XLogP | 2.11 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|