C33H58O5 — CID 139586699
(3E,5S,6S,7E,9S,10S,11E,13S,14S,15E,17R,18R,19S,21S)-6,10,14,18-tetrahydroxy-3,5,7,9,11,13,15,17,19,21-decamethyltricosa-3,7,11,15-tetraen-2-one (PubChem CID 139586699) has the molecular formula C33H58O5 and a molecular weight of 534.82 g/mol. Its IUPAC name is (3E,5S,6S,7E,9S,10S,11E,13S,14S,15E,17R,18R,19S,21S)-6,10,14,18-tetrahydroxy-3,5,7,9,11,13,15,17,19,21-decamethyltricosa-3,7,11,15-tetraen-2-one.
| Compound Name | (3E,5S,6S,7E,9S,10S,11E,13S,14S,15E,17R,18R,19S,21S)-6,10,14,18-tetrahydroxy-3,5,7,9,11,13,15,17,19,21-decamethyltricosa-3,7,11,15-tetraen-2-one |
|---|---|
| PubChem CID | 139586699 |
| Molecular Formula | C33H58O5 |
| Molecular Weight | 534.82 g/mol |
| Exact Mass | 534.43 |
| IUPAC Name | (3E,5S,6S,7E,9S,10S,11E,13S,14S,15E,17R,18R,19S,21S)-6,10,14,18-tetrahydroxy-3,5,7,9,11,13,15,17,19,21-decamethyltricosa-3,7,11,15-tetraen-2-one |
| SMILES | CC[C@H](C)C[C@H](C)[C@@H](O)[C@H](C)/C=C(\C)[C@@H](O)[C@@H](C)/C=C(\C)[C@@H](O)[C@@H](C)/C=C(\C)[C@@H](O)[C@@H](C)/C=C(\C)C(C)=O |
| InChI | InChI=1S/C33H58O5/c1-13-19(2)14-21(4)30(35)23(6)16-25(8)32(37)27(10)18-28(11)33(38)26(9)17-24(7)31(36)22(5)15-20(3)29(12)34/h15-19,21-23,26-27,30-33,35-38H,13-14H2,1-12H3/b20-15+,24-17+,25-16+,28-18+/t19-,21-,22-,23+,26-,27-,30+,31-,32+,33-/m0/s1 |
| InChIKey | JRHOHMAJDUWMNY-OVNCBTQESA-N |
| XLogP | 6.42 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.82 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|