(2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid

C7H10O4 — CID 139586819

IUPAC(2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid
SMILESC[C@@H]1C(=O)O[C@H](C)[C@H]1C(=O)O
InChIInChI=1S/C7H10O4/c1-3-5(6(8)9)4(2)11-7(3)10/h3-5H,1-2H3,(H,8,9)/t3-,4+,5-/m0/s1
InChIKeyLGLJEWALBGALSD-LMVFSUKVSA-N
MW158.15 g/mol
LogP0.27
Rot. Bonds1

About (2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid

(2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid (PubChem CID 139586819) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is (2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid.

Molecular Properties

Compound Name(2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid
PubChem CID139586819
Molecular FormulaC7H10O4
Molecular Weight158.15 g/mol
Exact Mass158.06
IUPAC Name(2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid
SMILESC[C@@H]1C(=O)O[C@H](C)[C@H]1C(=O)O
InChIInChI=1S/C7H10O4/c1-3-5(6(8)9)4(2)11-7(3)10/h3-5H,1-2H3,(H,8,9)/t3-,4+,5-/m0/s1
InChIKeyLGLJEWALBGALSD-LMVFSUKVSA-N
XLogP0.27
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.15
LogP ≤ 50.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Terebic acid
CID 101540
Terebic acid, (R)-
CID 736106
5,5-Dimethyloxolane-3-carboxylic acid
CID 121582920
(3R,4R)-4-[(1R)-1-hydroxyethyl]-3-methyloxolan-2-one
CID 118708001
4-(1-Hydroxyethyl)oxolan-2-one
CID 12664706
2,2-Dimethyloxolane-3-carboxylic acid
CID 21133941
5-Methyl-2-oxooxolane-3-carboxylic acid
CID 55299928
2-Methyloxolane-3-carboxylic acid
CID 66653552
5-Methyloxolane-3-carboxylic acid
CID 75481686
(4R)-4-[(1R)-1-hydroxyethyl]-5,5-dimethyloxolan-2-one
CID 15313663
(3R,4S,1'R)-3-(1'-hydroxyethyl)-4-methyldihydrofuran-2(3H)-one
CID 25154885
(2R,3R,4S)-2,4-dimethyl-5-oxotetrahydrofuran-3-carboxylic acid
CID 102021603

Frequently Asked Questions

What is the IUPAC name of (2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid?
The IUPAC name of (2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid (CID 139586819) is (2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid.
What is the SMILES notation for (2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid?
The canonical SMILES for (2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid is C[C@@H]1C(=O)O[C@H](C)[C@H]1C(=O)O.
What is the InChIKey of (2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid?
The InChIKey is LGLJEWALBGALSD-LMVFSUKVSA-N. The full InChI is InChI=1S/C7H10O4/c1-3-5(6(8)9)4(2)11-7(3)10/h3-5H,1-2H3,(H,8,9)/t3-,4+,5-/m0/s1.
What are the key properties of (2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid?
(2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid has a molecular weight of 158.15 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S,4S)-2,4-dimethyl-5-oxooxolane-3-carboxylic acid is sourced from PubChem (CID 139586819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).