About (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol
(E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol (PubChem CID 139586866) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol.
Molecular Properties
| Compound Name | (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol |
| PubChem CID | 139586866 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol |
| SMILES | C/C=C/C(=C/[C@@H]1CC[C@@H](C)O1)CO |
| InChI | InChI=1S/C11H18O2/c1-3-4-10(8-12)7-11-6-5-9(2)13-11/h3-4,7,9,11-12H,5-6,8H2,1-2H3/b4-3+,10-7-/t9-,11+/m1/s1 |
| InChIKey | KGMSVLHLHNQUSI-KEDYSELCSA-N |
| XLogP | 2.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol?
The IUPAC name of (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol (CID 139586866) is (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol.
What is the SMILES notation for (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol?
The canonical SMILES for (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol is C/C=C/C(=C/[C@@H]1CC[C@@H](C)O1)CO.
What is the InChIKey of (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol?
The InChIKey is KGMSVLHLHNQUSI-KEDYSELCSA-N. The full InChI is InChI=1S/C11H18O2/c1-3-4-10(8-12)7-11-6-5-9(2)13-11/h3-4,7,9,11-12H,5-6,8H2,1-2H3/b4-3+,10-7-/t9-,11+/m1/s1.
What are the key properties of (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol?
(E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol has a molecular weight of 182.26 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2Z)-2-[[(2S,5R)-5-methyloxolan-2-yl]methylidene]pent-3-en-1-ol is sourced from PubChem (CID 139586866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).