About 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde
4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde (PubChem CID 139586929) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde.
Molecular Properties
| Compound Name | 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde |
| PubChem CID | 139586929 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde |
| SMILES | C[C@H](CC1=C(C=O)COC1=O)C1=CCC(C)(C)C1 |
| InChI | InChI=1S/C15H20O3/c1-10(11-4-5-15(2,3)7-11)6-13-12(8-16)9-18-14(13)17/h4,8,10H,5-7,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | MGCQOVSJHJLATA-SNVBAGLBSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde?
The IUPAC name of 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde (CID 139586929) is 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde.
What is the SMILES notation for 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde?
The canonical SMILES for 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde is C[C@H](CC1=C(C=O)COC1=O)C1=CCC(C)(C)C1.
What is the InChIKey of 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde?
The InChIKey is MGCQOVSJHJLATA-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H20O3/c1-10(11-4-5-15(2,3)7-11)6-13-12(8-16)9-18-14(13)17/h4,8,10H,5-7,9H2,1-3H3/t10-/m1/s1.
What are the key properties of 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde?
4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde has a molecular weight of 248.32 g/mol, XLogP of 2.81, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]-5-oxo-2H-furan-3-carbaldehyde is sourced from PubChem (CID 139586929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).