C15H24O3 — CID 139586952
(2S,4R,6S,8S,9S,10S,12S)-4-(hydroxymethyl)-4,8,9-trimethyl-11-oxatetracyclo[6.4.0.02,6.010,12]dodecan-9-ol (PubChem CID 139586952) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (2S,4R,6S,8S,9S,10S,12S)-4-(hydroxymethyl)-4,8,9-trimethyl-11-oxatetracyclo[6.4.0.02,6.010,12]dodecan-9-ol.
| Compound Name | (2S,4R,6S,8S,9S,10S,12S)-4-(hydroxymethyl)-4,8,9-trimethyl-11-oxatetracyclo[6.4.0.02,6.010,12]dodecan-9-ol |
|---|---|
| PubChem CID | 139586952 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (2S,4R,6S,8S,9S,10S,12S)-4-(hydroxymethyl)-4,8,9-trimethyl-11-oxatetracyclo[6.4.0.02,6.010,12]dodecan-9-ol |
| SMILES | C[C@]1(CO)CC2C3[C@@H]4O[C@@H]4[C@@](C)(O)[C@@]3(C)C[C@@H]2C1 |
| InChI | InChI=1S/C15H24O3/c1-13(7-16)4-8-5-14(2)10(9(8)6-13)11-12(18-11)15(14,3)17/h8-12,16-17H,4-7H2,1-3H3/t8-,9?,10?,11-,12-,13+,14-,15+/m0/s1 |
| InChIKey | OCHFXMGZTXUYLJ-PUFFNTPJSA-N |
| XLogP | 1.57 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|