C25H40O3 — CID 139586972
(1R,2Z,4E,6S,8Z,15R,17R,18R)-4-(hydroxymethyl)-8,15-dimethyl-12-methylidene-18-propan-2-ylbicyclo[13.3.0]octadeca-2,4,8-triene-6,17-diol (PubChem CID 139586972) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is (1R,2Z,4E,6S,8Z,15R,17R,18R)-4-(hydroxymethyl)-8,15-dimethyl-12-methylidene-18-propan-2-ylbicyclo[13.3.0]octadeca-2,4,8-triene-6,17-diol.
| Compound Name | (1R,2Z,4E,6S,8Z,15R,17R,18R)-4-(hydroxymethyl)-8,15-dimethyl-12-methylidene-18-propan-2-ylbicyclo[13.3.0]octadeca-2,4,8-triene-6,17-diol |
|---|---|
| PubChem CID | 139586972 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | (1R,2Z,4E,6S,8Z,15R,17R,18R)-4-(hydroxymethyl)-8,15-dimethyl-12-methylidene-18-propan-2-ylbicyclo[13.3.0]octadeca-2,4,8-triene-6,17-diol |
| SMILES | C=C1CC/C=C(/C)C[C@H](O)/C=C(CO)\C=C/[C@@H]2[C@@H](C(C)C)[C@H](O)C[C@@]2(C)CC1 |
| InChI | InChI=1S/C25H40O3/c1-17(2)24-22-10-9-20(16-26)14-21(27)13-19(4)8-6-7-18(3)11-12-25(22,5)15-23(24)28/h8-10,14,17,21-24,26-28H,3,6-7,11-13,15-16H2,1-2,4-5H3/b10-9-,19-8-,20-14+/t21-,22+,23+,24+,25+/m0/s1 |
| InChIKey | INZNBTRIPSMDBL-UCARPSNNSA-N |
| XLogP | 4.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|