C25H40NO8P — CID 139586999
[(1E,4R,6R,7Z,9Z)-3-(2-aminoethyl)-10-cyclohexyl-1-[(2R,3S)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-3,6-dihydroxydeca-1,7,9-trien-4-yl] dihydrogen phosphate (PubChem CID 139586999) has the molecular formula C25H40NO8P and a molecular weight of 513.57 g/mol. Its IUPAC name is [(1E,4R,6R,7Z,9Z)-3-(2-aminoethyl)-10-cyclohexyl-1-[(2R,3S)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-3,6-dihydroxydeca-1,7,9-trien-4-yl] dihydrogen phosphate.
| Compound Name | [(1E,4R,6R,7Z,9Z)-3-(2-aminoethyl)-10-cyclohexyl-1-[(2R,3S)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-3,6-dihydroxydeca-1,7,9-trien-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 139586999 |
| Molecular Formula | C25H40NO8P |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | [(1E,4R,6R,7Z,9Z)-3-(2-aminoethyl)-10-cyclohexyl-1-[(2R,3S)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-3,6-dihydroxydeca-1,7,9-trien-4-yl] dihydrogen phosphate |
| SMILES | CC[C@H]1C=CC(=O)O[C@@H]1/C=C/C(O)(CCN)[C@@H](C[C@@H](O)/C=C\C=C/C1CCCCC1)OP(=O)(O)O |
| InChI | InChI=1S/C25H40NO8P/c1-2-20-12-13-24(28)33-22(20)14-15-25(29,16-17-26)23(34-35(30,31)32)18-21(27)11-7-6-10-19-8-4-3-5-9-19/h6-7,10-15,19-23,27,29H,2-5,8-9,16-18,26H2,1H3,(H2,30,31,32)/b10-6-,11-7-,15-14+/t20-,21-,22+,23+,25?/m0/s1 |
| InChIKey | GAIPQMSJLNWRGC-LLFZSTOQSA-N |
| XLogP | 3.05 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|