C28H34O9 — CID 139587090
methyl (1R,4S,5R,7S,9S,10R,12R,13S,15R)-15-acetyloxy-4,5,7,10,14,14-hexamethyl-6,8,18-trioxo-19,20-dioxahexacyclo[10.5.2.14,7.01,13.02,10.05,9]icos-2-ene-9-carboxylate (PubChem CID 139587090) has the molecular formula C28H34O9 and a molecular weight of 514.57 g/mol. Its IUPAC name is methyl (1R,4S,5R,7S,9S,10R,12R,13S,15R)-15-acetyloxy-4,5,7,10,14,14-hexamethyl-6,8,18-trioxo-19,20-dioxahexacyclo[10.5.2.14,7.01,13.02,10.05,9]icos-2-ene-9-carboxylate.
| Compound Name | methyl (1R,4S,5R,7S,9S,10R,12R,13S,15R)-15-acetyloxy-4,5,7,10,14,14-hexamethyl-6,8,18-trioxo-19,20-dioxahexacyclo[10.5.2.14,7.01,13.02,10.05,9]icos-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 139587090 |
| Molecular Formula | C28H34O9 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | methyl (1R,4S,5R,7S,9S,10R,12R,13S,15R)-15-acetyloxy-4,5,7,10,14,14-hexamethyl-6,8,18-trioxo-19,20-dioxahexacyclo[10.5.2.14,7.01,13.02,10.05,9]icos-2-ene-9-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)C3(C)O[C@@](C)(C=C4[C@@]56CC[C@@H](OC(C)=O)C(C)(C)[C@@H]5[C@@H](C[C@]41C)OC6=O)[C@]2(C)C3=O |
| InChI | InChI=1S/C28H34O9/c1-13(29)35-16-9-10-27-15-12-24(5)26(7)18(30)25(6,37-24)19(31)28(26,21(33)34-8)23(15,4)11-14(36-20(27)32)17(27)22(16,2)3/h12,14,16-17H,9-11H2,1-8H3/t14-,16-,17+,23-,24+,25?,26+,27+,28+/m1/s1 |
| InChIKey | WHFIOFZWSVQFDC-TTWDTTHTSA-N |
| XLogP | 2.48 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|