C12H16O5 — CID 139587156
(2S,3S,7S,7aS)-3-hydroxy-4-methoxy-7-methyl-2-prop-1-enyl-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-5-one (PubChem CID 139587156) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (2S,3S,7S,7aS)-3-hydroxy-4-methoxy-7-methyl-2-prop-1-enyl-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-5-one.
| Compound Name | (2S,3S,7S,7aS)-3-hydroxy-4-methoxy-7-methyl-2-prop-1-enyl-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-5-one |
|---|---|
| PubChem CID | 139587156 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2S,3S,7S,7aS)-3-hydroxy-4-methoxy-7-methyl-2-prop-1-enyl-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-5-one |
| SMILES | CC=C[C@@H]1O[C@H]2C(=C(OC)[C@H]1O)C(=O)O[C@H]2C |
| InChI | InChI=1S/C12H16O5/c1-4-5-7-9(13)11(15-3)8-10(17-7)6(2)16-12(8)14/h4-7,9-10,13H,1-3H3/t6-,7-,9-,10+/m0/s1 |
| InChIKey | MALLXYWJMJGPQU-ZRUAGYDASA-N |
| XLogP | 0.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|