C13H22O4 — CID 139587256
(3R,4R,5S,6R)-4-hydroxy-6-[(E)-3-hydroxy-3-methylpent-1-enyl]-3,5-dimethyloxan-2-one (PubChem CID 139587256) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (3R,4R,5S,6R)-4-hydroxy-6-[(E)-3-hydroxy-3-methylpent-1-enyl]-3,5-dimethyloxan-2-one.
| Compound Name | (3R,4R,5S,6R)-4-hydroxy-6-[(E)-3-hydroxy-3-methylpent-1-enyl]-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 139587256 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (3R,4R,5S,6R)-4-hydroxy-6-[(E)-3-hydroxy-3-methylpent-1-enyl]-3,5-dimethyloxan-2-one |
| SMILES | CCC(C)(O)/C=C/[C@H]1OC(=O)[C@H](C)[C@H](O)[C@@H]1C |
| InChI | InChI=1S/C13H22O4/c1-5-13(4,16)7-6-10-8(2)11(14)9(3)12(15)17-10/h6-11,14,16H,5H2,1-4H3/b7-6+/t8-,9-,10-,11-,13?/m1/s1 |
| InChIKey | GIMCNFHSLMRMLR-YAOZRLOFSA-N |
| XLogP | 1.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|