C15H21Br2ClO — CID 139587344
(2S,6R)-4,10-dibromo-9-chloro-2,5,5,9-tetramethylspiro[5.5]undec-3-en-1-one (PubChem CID 139587344) has the molecular formula C15H21Br2ClO and a molecular weight of 412.59 g/mol. Its IUPAC name is (2S,6R)-4,10-dibromo-9-chloro-2,5,5,9-tetramethylspiro[5.5]undec-3-en-1-one.
| Compound Name | (2S,6R)-4,10-dibromo-9-chloro-2,5,5,9-tetramethylspiro[5.5]undec-3-en-1-one |
|---|---|
| PubChem CID | 139587344 |
| Molecular Formula | C15H21Br2ClO |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | (2S,6R)-4,10-dibromo-9-chloro-2,5,5,9-tetramethylspiro[5.5]undec-3-en-1-one |
| SMILES | C[C@H]1C=C(Br)C(C)(C)[C@]2(CCC(C)(Cl)C(Br)C2)C1=O |
| InChI | InChI=1S/C15H21Br2ClO/c1-9-7-10(16)13(2,3)15(12(9)19)6-5-14(4,18)11(17)8-15/h7,9,11H,5-6,8H2,1-4H3/t9-,11?,14?,15-/m0/s1 |
| InChIKey | HMWLZIQJSYGFHO-MIEXDMTOSA-N |
| XLogP | 5.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|