C26H32O8 — CID 139587407
methyl (1R,2S,11R,12R,14R,16R)-16-acetyloxy-11-hydroxy-2,6,6,11,14-pentamethyl-17-methylidene-8,15-dioxo-7-oxatetracyclo[12.2.1.02,12.05,10]heptadeca-4,9-diene-1-carboxylate (PubChem CID 139587407) has the molecular formula C26H32O8 and a molecular weight of 472.53 g/mol. Its IUPAC name is methyl (1R,2S,11R,12R,14R,16R)-16-acetyloxy-11-hydroxy-2,6,6,11,14-pentamethyl-17-methylidene-8,15-dioxo-7-oxatetracyclo[12.2.1.02,12.05,10]heptadeca-4,9-diene-1-carboxylate.
| Compound Name | methyl (1R,2S,11R,12R,14R,16R)-16-acetyloxy-11-hydroxy-2,6,6,11,14-pentamethyl-17-methylidene-8,15-dioxo-7-oxatetracyclo[12.2.1.02,12.05,10]heptadeca-4,9-diene-1-carboxylate |
|---|---|
| PubChem CID | 139587407 |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | methyl (1R,2S,11R,12R,14R,16R)-16-acetyloxy-11-hydroxy-2,6,6,11,14-pentamethyl-17-methylidene-8,15-dioxo-7-oxatetracyclo[12.2.1.02,12.05,10]heptadeca-4,9-diene-1-carboxylate |
| SMILES | C=C1[C@@]2(C)C[C@H]3[C@@](C)(O)C4=CC(=O)OC(C)(C)C4=CC[C@]3(C)[C@]1(C(=O)OC)[C@@H](OC(C)=O)C2=O |
| InChI | InChI=1S/C26H32O8/c1-13-23(5)12-17-24(6,26(13,21(30)32-8)20(19(23)29)33-14(2)27)10-9-15-16(25(17,7)31)11-18(28)34-22(15,3)4/h9,11,17,20,31H,1,10,12H2,2-8H3/t17-,20+,23-,24+,25+,26+/m1/s1 |
| InChIKey | IIIVMNUBQBBBCC-OZVRMPIOSA-N |
| XLogP | 2.59 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|