C30H52 — CID 139587437
(6aR,6bR,8aR,12aS,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicene (PubChem CID 139587437) has the molecular formula C30H52 and a molecular weight of 412.75 g/mol. Its IUPAC name is (6aR,6bR,8aR,12aS,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicene.
| Compound Name | (6aR,6bR,8aR,12aS,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicene |
|---|---|
| PubChem CID | 139587437 |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | (6aR,6bR,8aR,12aS,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicene |
| SMILES | CC1(C)CC[C@]2(C)CC[C@]3(C)C(CCC4[C@@]5(C)CCCC(C)(C)C5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C30H52/c1-25(2)16-17-27(5)18-19-29(7)21(22(27)20-25)10-11-24-28(6)14-9-13-26(3,4)23(28)12-15-30(24,29)8/h21-24H,9-20H2,1-8H3/t21?,22-,23?,24?,27+,28-,29+,30+/m0/s1 |
| InChIKey | VCNKUCWWHVTTBY-WPABYYHASA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |