C30H52O4 — CID 139587442
(1R,3E,7E,11E)-3,7,11,16-tetramethyl-1-[(2R,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]heptadeca-3,7,11-triene-1,15,16-triol (PubChem CID 139587442) has the molecular formula C30H52O4 and a molecular weight of 476.74 g/mol. Its IUPAC name is (1R,3E,7E,11E)-3,7,11,16-tetramethyl-1-[(2R,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]heptadeca-3,7,11-triene-1,15,16-triol.
| Compound Name | (1R,3E,7E,11E)-3,7,11,16-tetramethyl-1-[(2R,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]heptadeca-3,7,11-triene-1,15,16-triol |
|---|---|
| PubChem CID | 139587442 |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | (1R,3E,7E,11E)-3,7,11,16-tetramethyl-1-[(2R,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]heptadeca-3,7,11-triene-1,15,16-triol |
| SMILES | CC(C)=CCC[C@@]1(C)O[C@@H]1[C@H](O)C/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC(O)C(C)(C)O |
| InChI | InChI=1S/C30H52O4/c1-22(2)13-12-20-30(8)28(34-30)26(31)21-25(5)18-10-16-23(3)14-9-15-24(4)17-11-19-27(32)29(6,7)33/h13-14,17-18,26-28,31-33H,9-12,15-16,19-21H2,1-8H3/b23-14+,24-17+,25-18+/t26-,27?,28-,30-/m1/s1 |
| InChIKey | LPNKJWZZQWWOLJ-LDHSXERCSA-N |
| XLogP | 6.95 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|