C32H37N3O3 — CID 139587500
(2R,5S,6R,7S,9S,10R,14S,16S)-9-hydroxy-5-(1H-indol-3-ylmethyl)-7,14,16-trimethyl-8-methylidene-4,21-diazatetracyclo[16.2.1.02,6.02,10]henicosa-1(20),11,18-triene-3,17-dione (PubChem CID 139587500) has the molecular formula C32H37N3O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is (2R,5S,6R,7S,9S,10R,14S,16S)-9-hydroxy-5-(1H-indol-3-ylmethyl)-7,14,16-trimethyl-8-methylidene-4,21-diazatetracyclo[16.2.1.02,6.02,10]henicosa-1(20),11,18-triene-3,17-dione.
| Compound Name | (2R,5S,6R,7S,9S,10R,14S,16S)-9-hydroxy-5-(1H-indol-3-ylmethyl)-7,14,16-trimethyl-8-methylidene-4,21-diazatetracyclo[16.2.1.02,6.02,10]henicosa-1(20),11,18-triene-3,17-dione |
|---|---|
| PubChem CID | 139587500 |
| Molecular Formula | C32H37N3O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | (2R,5S,6R,7S,9S,10R,14S,16S)-9-hydroxy-5-(1H-indol-3-ylmethyl)-7,14,16-trimethyl-8-methylidene-4,21-diazatetracyclo[16.2.1.02,6.02,10]henicosa-1(20),11,18-triene-3,17-dione |
| SMILES | C=C1[C@@H](C)[C@H]2[C@H](Cc3c[nH]c4ccccc34)NC(=O)[C@]23c2ccc([nH]2)C(=O)[C@@H](C)C[C@@H](C)CC=C[C@H]3[C@@H]1O |
| InChI | InChI=1S/C32H37N3O3/c1-17-8-7-10-23-30(37)20(4)19(3)28-26(15-21-16-33-24-11-6-5-9-22(21)24)35-31(38)32(23,28)27-13-12-25(34-27)29(36)18(2)14-17/h5-7,9-13,16-19,23,26,28,30,33-34,37H,4,8,14-15H2,1-3H3,(H,35,38)/t17-,18-,19+,23-,26-,28-,30+,32+/m0/s1 |
| InChIKey | WLHBPBAMXYPYBT-NOSDXMCJSA-N |
| XLogP | 5.08 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|