C32H35N3O3 — CID 139587521
(2S,5S,6R,7S,10S,14S)-8-(hydroxymethyl)-5-(1H-indol-3-ylmethyl)-7,14,16-trimethyl-4,21-diazatetracyclo[16.2.1.02,6.02,10]henicosa-1(20),8,11,15,18-pentaene-3,17-dione (PubChem CID 139587521) has the molecular formula C32H35N3O3 and a molecular weight of 509.65 g/mol. Its IUPAC name is (2S,5S,6R,7S,10S,14S)-8-(hydroxymethyl)-5-(1H-indol-3-ylmethyl)-7,14,16-trimethyl-4,21-diazatetracyclo[16.2.1.02,6.02,10]henicosa-1(20),8,11,15,18-pentaene-3,17-dione.
| Compound Name | (2S,5S,6R,7S,10S,14S)-8-(hydroxymethyl)-5-(1H-indol-3-ylmethyl)-7,14,16-trimethyl-4,21-diazatetracyclo[16.2.1.02,6.02,10]henicosa-1(20),8,11,15,18-pentaene-3,17-dione |
|---|---|
| PubChem CID | 139587521 |
| Molecular Formula | C32H35N3O3 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | (2S,5S,6R,7S,10S,14S)-8-(hydroxymethyl)-5-(1H-indol-3-ylmethyl)-7,14,16-trimethyl-4,21-diazatetracyclo[16.2.1.02,6.02,10]henicosa-1(20),8,11,15,18-pentaene-3,17-dione |
| SMILES | CC1=C[C@@H](C)CC=C[C@H]2C=C(CO)[C@@H](C)[C@H]3[C@H](Cc4c[nH]c5ccccc45)NC(=O)[C@@]23c2ccc([nH]2)C1=O |
| InChI | InChI=1S/C32H35N3O3/c1-18-7-6-8-23-14-22(17-36)20(3)29-27(15-21-16-33-25-10-5-4-9-24(21)25)35-31(38)32(23,29)28-12-11-26(34-28)30(37)19(2)13-18/h4-6,8-14,16,18,20,23,27,29,33-34,36H,7,15,17H2,1-3H3,(H,35,38)/t18-,20+,23-,27-,29-,32+/m0/s1 |
| InChIKey | RUJBSNUQPZHAFN-YORJNJFPSA-N |
| XLogP | 5.00 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|