C24H38O5 — CID 139587615
[8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7,8a-trimethyl-2,3,4,4a,7,8-hexahydro-1H-naphthalen-1-yl] 2-methylpropanoate (PubChem CID 139587615) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is [8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7,8a-trimethyl-2,3,4,4a,7,8-hexahydro-1H-naphthalen-1-yl] 2-methylpropanoate.
| Compound Name | [8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7,8a-trimethyl-2,3,4,4a,7,8-hexahydro-1H-naphthalen-1-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 139587615 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7,8a-trimethyl-2,3,4,4a,7,8-hexahydro-1H-naphthalen-1-yl] 2-methylpropanoate |
| SMILES | CC1CC2C=CC(C)C(CCC3CC(O)CC(=O)O3)C2(C)C(OC(=O)C(C)C)C1 |
| InChI | InChI=1S/C24H38O5/c1-14(2)23(27)29-21-11-15(3)10-17-7-6-16(4)20(24(17,21)5)9-8-19-12-18(25)13-22(26)28-19/h6-7,14-21,25H,8-13H2,1-5H3 |
| InChIKey | SNZFZCATEUKWED-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|