About (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide
(E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide (PubChem CID 139587683) has the molecular formula C31H59N3O3
and a molecular weight of 521.83 g/mol. Its IUPAC name is (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide.
Molecular Properties
| Compound Name | (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide |
| PubChem CID | 139587683 |
| Molecular Formula | C31H59N3O3 |
| Molecular Weight | 521.83 g/mol |
| Exact Mass | 521.46 |
| IUPAC Name | (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide |
| SMILES | CC(=O)NCCCCN(CCCCNC(C)=O)C(=O)CCCC/C=C/CCCCCCCCCC(C)C |
| InChI | InChI=1S/C31H59N3O3/c1-28(2)22-16-14-12-10-8-6-5-7-9-11-13-15-17-23-31(37)34(26-20-18-24-32-29(3)35)27-21-19-25-33-30(4)36/h9,11,28H,5-8,10,12-27H2,1-4H3,(H,32,35)(H,33,36)/b11-9+ |
| InChIKey | FVEUONPKDFCLLI-PKNBQFBNSA-N |
| XLogP | 6.93 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.83 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide?
The IUPAC name of (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide (CID 139587683) is (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide.
What is the SMILES notation for (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide?
The canonical SMILES for (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide is CC(=O)NCCCCN(CCCCNC(C)=O)C(=O)CCCC/C=C/CCCCCCCCCC(C)C.
What is the InChIKey of (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide?
The InChIKey is FVEUONPKDFCLLI-PKNBQFBNSA-N. The full InChI is InChI=1S/C31H59N3O3/c1-28(2)22-16-14-12-10-8-6-5-7-9-11-13-15-17-23-31(37)34(26-20-18-24-32-29(3)35)27-21-19-25-33-30(4)36/h9,11,28H,5-8,10,12-27H2,1-4H3,(H,32,35)(H,33,36)/b11-9+.
What are the key properties of (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide?
(E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide has a molecular weight of 521.83 g/mol, XLogP of 6.93, 25 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-bis(4-acetamidobutyl)-17-methyloctadec-6-enamide is sourced from PubChem (CID 139587683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).