C15H23ClO2 — CID 139587693
(1S,6R)-9-chloro-2,2,6,8-tetramethyl-7-oxatricyclo[6.2.2.01,6]dodecan-4-one (PubChem CID 139587693) has the molecular formula C15H23ClO2 and a molecular weight of 270.80 g/mol. Its IUPAC name is (1S,6R)-9-chloro-2,2,6,8-tetramethyl-7-oxatricyclo[6.2.2.01,6]dodecan-4-one.
| Compound Name | (1S,6R)-9-chloro-2,2,6,8-tetramethyl-7-oxatricyclo[6.2.2.01,6]dodecan-4-one |
|---|---|
| PubChem CID | 139587693 |
| Molecular Formula | C15H23ClO2 |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (1S,6R)-9-chloro-2,2,6,8-tetramethyl-7-oxatricyclo[6.2.2.01,6]dodecan-4-one |
| SMILES | CC12CC[C@]3(CC1Cl)C(C)(C)CC(=O)C[C@@]3(C)O2 |
| InChI | InChI=1S/C15H23ClO2/c1-12(2)7-10(17)8-14(4)15(12)6-5-13(3,18-14)11(16)9-15/h11H,5-9H2,1-4H3/t11?,13?,14-,15+/m1/s1 |
| InChIKey | NDZAVQHKUNPCET-AXVKAWJUSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|