C24H30O7 — CID 139587711
methyl (1R,2S,11R,12R,14R,15R)-11,15-dihydroxy-2,6,6,11,14-pentamethyl-17-methylidene-8,16-dioxo-7-oxatetracyclo[12.2.1.02,12.05,10]heptadeca-4,9-diene-1-carboxylate (PubChem CID 139587711) has the molecular formula C24H30O7 and a molecular weight of 430.50 g/mol. Its IUPAC name is methyl (1R,2S,11R,12R,14R,15R)-11,15-dihydroxy-2,6,6,11,14-pentamethyl-17-methylidene-8,16-dioxo-7-oxatetracyclo[12.2.1.02,12.05,10]heptadeca-4,9-diene-1-carboxylate.
| Compound Name | methyl (1R,2S,11R,12R,14R,15R)-11,15-dihydroxy-2,6,6,11,14-pentamethyl-17-methylidene-8,16-dioxo-7-oxatetracyclo[12.2.1.02,12.05,10]heptadeca-4,9-diene-1-carboxylate |
|---|---|
| PubChem CID | 139587711 |
| Molecular Formula | C24H30O7 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | methyl (1R,2S,11R,12R,14R,15R)-11,15-dihydroxy-2,6,6,11,14-pentamethyl-17-methylidene-8,16-dioxo-7-oxatetracyclo[12.2.1.02,12.05,10]heptadeca-4,9-diene-1-carboxylate |
| SMILES | C=C1[C@@]2(C(=O)OC)C(=O)[C@H](O)[C@]1(C)C[C@H]1[C@@](C)(O)C3=CC(=O)OC(C)(C)C3=CC[C@@]12C |
| InChI | InChI=1S/C24H30O7/c1-12-21(4)11-15-22(5,24(12,19(28)30-7)18(27)17(21)26)9-8-13-14(23(15,6)29)10-16(25)31-20(13,2)3/h8,10,15,17,26,29H,1,9,11H2,2-7H3/t15-,17+,21-,22+,23+,24+/m1/s1 |
| InChIKey | NFTKIUNNMLJEDD-SDWXISRUSA-N |
| XLogP | 2.02 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|