C17H24O4 — CID 139587747
[(1R,2R,8R,8aR)-8-hydroxy-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] acetate (PubChem CID 139587747) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(1R,2R,8R,8aR)-8-hydroxy-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(1R,2R,8R,8aR)-8-hydroxy-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 139587747 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(1R,2R,8R,8aR)-8-hydroxy-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC2=CC(=O)C(=C(C)C)[C@H](O)[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C17H24O4/c1-9(2)15-13(19)8-12-6-7-14(21-11(4)18)10(3)17(12,5)16(15)20/h8,10,14,16,20H,6-7H2,1-5H3/t10-,14+,16-,17+/m0/s1 |
| InChIKey | NNGHEUBMPRTIIB-KYTKNBDNSA-N |
| XLogP | 2.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|