C15H24O3 — CID 139587794
(1S,2S,6S,7R,8R,9S)-8-hydroxy-6-(hydroxymethyl)-2,6,9-trimethyltricyclo[5.4.0.02,9]undecan-11-one (PubChem CID 139587794) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1S,2S,6S,7R,8R,9S)-8-hydroxy-6-(hydroxymethyl)-2,6,9-trimethyltricyclo[5.4.0.02,9]undecan-11-one.
| Compound Name | (1S,2S,6S,7R,8R,9S)-8-hydroxy-6-(hydroxymethyl)-2,6,9-trimethyltricyclo[5.4.0.02,9]undecan-11-one |
|---|---|
| PubChem CID | 139587794 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1S,2S,6S,7R,8R,9S)-8-hydroxy-6-(hydroxymethyl)-2,6,9-trimethyltricyclo[5.4.0.02,9]undecan-11-one |
| SMILES | C[C@]1(CO)CCC[C@@]2(C)[C@H]3C(=O)C[C@]2(C)[C@H](O)[C@H]31 |
| InChI | InChI=1S/C15H24O3/c1-13(8-16)5-4-6-14(2)10-9(17)7-15(14,3)12(18)11(10)13/h10-12,16,18H,4-8H2,1-3H3/t10-,11-,12+,13+,14-,15+/m0/s1 |
| InChIKey | BLLSFQDOGXKOPW-JRULLXGZSA-N |
| XLogP | 1.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |