C17H26O3 — CID 139587978
2-[(2E,4E,6E,8E)-deca-2,4,6,8-tetraen-2-yl]-4-methoxy-5-methyloxan-3-ol (PubChem CID 139587978) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-[(2E,4E,6E,8E)-deca-2,4,6,8-tetraen-2-yl]-4-methoxy-5-methyloxan-3-ol.
| Compound Name | 2-[(2E,4E,6E,8E)-deca-2,4,6,8-tetraen-2-yl]-4-methoxy-5-methyloxan-3-ol |
|---|---|
| PubChem CID | 139587978 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-[(2E,4E,6E,8E)-deca-2,4,6,8-tetraen-2-yl]-4-methoxy-5-methyloxan-3-ol |
| SMILES | C/C=C/C=C/C=C/C=C(\C)C1OCC(C)C(OC)C1O |
| InChI | InChI=1S/C17H26O3/c1-5-6-7-8-9-10-11-13(2)17-15(18)16(19-4)14(3)12-20-17/h5-11,14-18H,12H2,1-4H3/b6-5+,8-7+,10-9+,13-11+ |
| InChIKey | BWSYYLSLQRWYIN-ZQNRIKKJSA-N |
| XLogP | 3.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|